Salts and Inorganics
A variety of inorganic salts and elemental metals that can be used for large-scale, industrial purposes and everyday laboratory applications. Products are available in a range of chemical compositions, quantities, purities, and reagent grades.
Inorganics are elements and compounds, including carbon monoxide, carbon dioxide, carbonates, cyanides, cyanates, and carbides, that do not contain a carbon-hydrogen bond. This group also includes carbon allotropes such as graphite and graphene.
Because organic chemicals include only those that contain carbon atoms bonded to hydrogen atoms, the majority of elements in the periodic table and most substances in the material world are considered to be inorganic chemicals.
Filtered Search Results
Palladium(II) 2,4-pentanedionate, Pd 34.7%
CAS: 14024-61-4 Molecular Formula: C10H14O4Pd Molecular Weight (g/mol): 304.64 MDL Number: MFCD00000025 MFCD00000025 InChI Key: JKDRQYIYVJVOPF-FDGPNNRMSA-L Synonym: palladium diacetonate,acetylacetone palladium ii salt,bis 2,4-pentanedionato palladium ii PubChem CID: 53384484 IUPAC Name: (E)-4-oxopent-2-en-2-olate;palladium(2+) SMILES: [Pd++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O
| PubChem CID | 53384484 |
|---|---|
| CAS | 14024-61-4 |
| Molecular Weight (g/mol) | 304.64 |
| MDL Number | MFCD00000025 MFCD00000025 |
| SMILES | [Pd++].C\C([O-])=C\C(C)=O.C\C([O-])=C\C(C)=O |
| Synonym | palladium diacetonate,acetylacetone palladium ii salt,bis 2,4-pentanedionato palladium ii |
| IUPAC Name | (E)-4-oxopent-2-en-2-olate;palladium(2+) |
| InChI Key | JKDRQYIYVJVOPF-FDGPNNRMSA-L |
| Molecular Formula | C10H14O4Pd |
Mullite
CAS: 1302-93-8 Molecular Formula: Al6O13Si2 Molecular Weight (g/mol): 426.05 MDL Number: MFCD00058866 InChI Key: KZHJGOXRZJKJNY-UHFFFAOYSA-N Synonym: Aluminum oxide/silicon oxide
| CAS | 1302-93-8 |
|---|---|
| Molecular Weight (g/mol) | 426.05 |
| MDL Number | MFCD00058866 |
| Synonym | Aluminum oxide/silicon oxide |
| InChI Key | KZHJGOXRZJKJNY-UHFFFAOYSA-N |
| Molecular Formula | Al6O13Si2 |
Sodium molybdenum oxide dihydrate, ACS, 99.5-103.0%
CAS: 10102-40-6 Molecular Formula: H4MoNa2O6 Molecular Weight (g/mol): 241.96 MDL Number: MFCD00149170 InChI Key: FDEIWTXVNPKYDL-UHFFFAOYSA-N Synonym: sodium molybdate dihydrate,sodium molybdate vi dihydrate,disodium molybdate dihydrate,unii-8f2sxi1704,na2moo4.2h2o,disodium dihydrate molybdate,molybdic acid sodium salt dihydrate,molybdic acid, disodium salt, dihydrate,sodium molybdate 2 hydrate,dipotassium dihydrate molybdate PubChem CID: 16211258 ChEBI: CHEBI:75213 IUPAC Name: disodium dioxomolybdenumbis(olate) dihydrate SMILES: O.O.[Na+].[Na+].[O-][Mo]([O-])(=O)=O
| PubChem CID | 16211258 |
|---|---|
| CAS | 10102-40-6 |
| Molecular Weight (g/mol) | 241.96 |
| ChEBI | CHEBI:75213 |
| MDL Number | MFCD00149170 |
| SMILES | O.O.[Na+].[Na+].[O-][Mo]([O-])(=O)=O |
| Synonym | sodium molybdate dihydrate,sodium molybdate vi dihydrate,disodium molybdate dihydrate,unii-8f2sxi1704,na2moo4.2h2o,disodium dihydrate molybdate,molybdic acid sodium salt dihydrate,molybdic acid, disodium salt, dihydrate,sodium molybdate 2 hydrate,dipotassium dihydrate molybdate |
| IUPAC Name | disodium dioxomolybdenumbis(olate) dihydrate |
| InChI Key | FDEIWTXVNPKYDL-UHFFFAOYSA-N |
| Molecular Formula | H4MoNa2O6 |
Selenic acid, 40% aq. soln.
CAS: 7783-08-6 MDL Number: MFCD00012191 Synonym: selenic vi acid,h2seo4,unii-hv0y51nc4j,hv0y51nc4j,hsdb 675,dihydroxidodioxidoselenium,h2so4e,aq. soln.,seo2 oh 2 ChEBI: CHEBI:18170
| CAS | 7783-08-6 |
|---|---|
| ChEBI | CHEBI:18170 |
| MDL Number | MFCD00012191 |
| Synonym | selenic vi acid,h2seo4,unii-hv0y51nc4j,hv0y51nc4j,hsdb 675,dihydroxidodioxidoselenium,h2so4e,aq. soln.,seo2 oh 2 |
Zirconium silicate, Thermo Scientific Chemicals
CAS: 10101-52-7 Molecular Formula: O4SiZr Molecular Weight (g/mol): 183.31 MDL Number: MFCD00085353 InChI Key: GFQYVLUOOAAOGM-UHFFFAOYSA-N Synonym: zirconium silicate,hyacinth,zircon,zircon zr sio4,zirconite,zircosil 15,standard sf 200,ultrox 500w,a-pax 45m,zirconium iv silicate PubChem CID: 61775 IUPAC Name: zirconium(4+);silicate SMILES: [Zr+4].[O-][Si]([O-])([O-])[O-]
| PubChem CID | 61775 |
|---|---|
| CAS | 10101-52-7 |
| Molecular Weight (g/mol) | 183.31 |
| MDL Number | MFCD00085353 |
| SMILES | [Zr+4].[O-][Si]([O-])([O-])[O-] |
| Synonym | zirconium silicate,hyacinth,zircon,zircon zr sio4,zirconite,zircosil 15,standard sf 200,ultrox 500w,a-pax 45m,zirconium iv silicate |
| IUPAC Name | zirconium(4+);silicate |
| InChI Key | GFQYVLUOOAAOGM-UHFFFAOYSA-N |
| Molecular Formula | O4SiZr |
Gallium(III) oxide, 99.99% (metals basis)
CAS: 12024-21-4 Molecular Formula: Ga2O3 Molecular Weight (g/mol): 187.44 MDL Number: MFCD00011020 InChI Key: AJNVQOSZGJRYEI-UHFFFAOYSA-N IUPAC Name: digallium(3+) trioxidandiide SMILES: [O--].[O--].[O--].[Ga+3].[Ga+3]
| CAS | 12024-21-4 |
|---|---|
| Molecular Weight (g/mol) | 187.44 |
| MDL Number | MFCD00011020 |
| SMILES | [O--].[O--].[O--].[Ga+3].[Ga+3] |
| IUPAC Name | digallium(3+) trioxidandiide |
| InChI Key | AJNVQOSZGJRYEI-UHFFFAOYSA-N |
| Molecular Formula | Ga2O3 |
Thulium powder, -40 mesh, 99.9% (REO)
CAS: 7440-30-4 Molecular Formula: Tm Molecular Weight (g/mol): 168.93 MDL Number: MFCD00011281 InChI Key: FRNOGLGSGLTDKL-UHFFFAOYSA-N Synonym: tulio,unii-8rkc5ati4p,8rkc5ati4p,atom,pieces,powder,foil,acmc-20ajig,thulium, ingot,pieces, sublimed dendritic PubChem CID: 23961 ChEBI: CHEBI:33380 IUPAC Name: thulium SMILES: [Tm]
| PubChem CID | 23961 |
|---|---|
| CAS | 7440-30-4 |
| Molecular Weight (g/mol) | 168.93 |
| ChEBI | CHEBI:33380 |
| MDL Number | MFCD00011281 |
| SMILES | [Tm] |
| Synonym | tulio,unii-8rkc5ati4p,8rkc5ati4p,atom,pieces,powder,foil,acmc-20ajig,thulium, ingot,pieces, sublimed dendritic |
| IUPAC Name | thulium |
| InChI Key | FRNOGLGSGLTDKL-UHFFFAOYSA-N |
| Molecular Formula | Tm |
Holmium pieces, 99.9% (metals basis excluding Ta)
CAS: 7440-60-0 Molecular Formula: Ho Molecular Weight (g/mol): 164.93 MDL Number: MFCD00011049 InChI Key: KJZYNXUDTRRSPN-UHFFFAOYSA-N Synonym: atom,unii-w1xx32sqn1,w1xx32sqn1,foil,holmio,chips,ingot,pieces,powder,acmc-1c9ym PubChem CID: 23988 ChEBI: CHEBI:49648 IUPAC Name: holmium SMILES: [Ho]
| PubChem CID | 23988 |
|---|---|
| CAS | 7440-60-0 |
| Molecular Weight (g/mol) | 164.93 |
| ChEBI | CHEBI:49648 |
| MDL Number | MFCD00011049 |
| SMILES | [Ho] |
| Synonym | atom,unii-w1xx32sqn1,w1xx32sqn1,foil,holmio,chips,ingot,pieces,powder,acmc-1c9ym |
| IUPAC Name | holmium |
| InChI Key | KJZYNXUDTRRSPN-UHFFFAOYSA-N |
| Molecular Formula | Ho |
Neodymium powder, -40 mesh, 99.8% (REO)
CAS: 7440-00-8 Molecular Formula: Nd Molecular Weight (g/mol): 144.24 MDL Number: MFCD00011130 InChI Key: QEFYFXOXNSNQGX-UHFFFAOYSA-N Synonym: neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n PubChem CID: 23934 ChEBI: CHEBI:33372 IUPAC Name: neodymium SMILES: [Nd]
| PubChem CID | 23934 |
|---|---|
| CAS | 7440-00-8 |
| Molecular Weight (g/mol) | 144.24 |
| ChEBI | CHEBI:33372 |
| MDL Number | MFCD00011130 |
| SMILES | [Nd] |
| Synonym | neodimio,neodyme,neodym,trihydride,ingot reo,neodymium, ion nd5+,atom,ingot,iii,foil, 3n |
| IUPAC Name | neodymium |
| InChI Key | QEFYFXOXNSNQGX-UHFFFAOYSA-N |
| Molecular Formula | Nd |
Silicon(IV) oxide, powder, 0.5 micron, 99.9%
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Ammonium iron(II) sulfate hexahydrate, 99+%, for analysis
CAS: 7783-85-9 Molecular Formula: FeH20N2O14S2 Molecular Weight (g/mol): 392.13 MDL Number: MFCD00150530 InChI Key: MQLVWQSVRZVNIP-UHFFFAOYSA-L Synonym: Ferrous ammonium sulfate,Mohr's salt IUPAC Name: λ²-iron(2+) diammonium hexahydrate disulfate SMILES: [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O
| CAS | 7783-85-9 |
|---|---|
| Molecular Weight (g/mol) | 392.13 |
| MDL Number | MFCD00150530 |
| SMILES | [NH4+].[NH4+].O.O.O.O.O.O.[Fe++].[O-]S([O-])(=O)=O.[O-]S([O-])(=O)=O |
| Synonym | Ferrous ammonium sulfate,Mohr's salt |
| IUPAC Name | λ²-iron(2+) diammonium hexahydrate disulfate |
| InChI Key | MQLVWQSVRZVNIP-UHFFFAOYSA-L |
| Molecular Formula | FeH20N2O14S2 |
Silicon(IV) oxide, powder, 1.5 micron, 99.9%
CAS: 7631-86-9 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 IUPAC Name: dioxosilane SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 7631-86-9 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232 MFCD00217788 MFCD00163736 MFCD00148266 MFCD00603035 MFCD02100519 MFCD06202255 MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| IUPAC Name | dioxosilane |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Silicon(IV) oxide, 99% (metals basis)
CAS: 14808-60-7 Molecular Formula: O2Si Molecular Weight (g/mol): 60.08 MDL Number: MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 InChI Key: VYPSYNLAJGMNEJ-UHFFFAOYSA-N Synonym: silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous PubChem CID: 24261 ChEBI: CHEBI:30563 SMILES: O=[Si]=O
| PubChem CID | 24261 |
|---|---|
| CAS | 14808-60-7 |
| Molecular Weight (g/mol) | 60.08 |
| ChEBI | CHEBI:30563 |
| MDL Number | MFCD00011232,MFCD00217788,MFCD00163736,MFCD07370733 |
| SMILES | O=[Si]=O |
| Synonym | silica,silicon dioxide,quartz,cristobalite,diatomaceous earth,tridymite,silicic anhydride,aerosil,infusorial earth,silica, amorphous |
| InChI Key | VYPSYNLAJGMNEJ-UHFFFAOYSA-N |
| Molecular Formula | O2Si |
Lithium sulfate monohydrate, 99+%, pure
CAS: 10102-25-7 Molecular Formula: H2Li2O5S Molecular Weight (g/mol): 127.95 MDL Number: MFCD00149766 InChI Key: RKGLUDFWIKNKMX-UHFFFAOYSA-L Synonym: lithium sulfate monohydrate,dilithium 1+ ion hydrate sulfate,dilithium sulfate hydrate,sufuric acid, dilithium slat, monohydrate,lithiumsulfatemonohydrate,dilithotab hydrate sulfate,lithium sulphate monohydrate,lithium sulfate, acs,ksc181s7n PubChem CID: 165815 IUPAC Name: dilithium;sulfate;hydrate SMILES: [Li+].[Li+].O.[O-]S([O-])(=O)=O
| PubChem CID | 165815 |
|---|---|
| CAS | 10102-25-7 |
| Molecular Weight (g/mol) | 127.95 |
| MDL Number | MFCD00149766 |
| SMILES | [Li+].[Li+].O.[O-]S([O-])(=O)=O |
| Synonym | lithium sulfate monohydrate,dilithium 1+ ion hydrate sulfate,dilithium sulfate hydrate,sufuric acid, dilithium slat, monohydrate,lithiumsulfatemonohydrate,dilithotab hydrate sulfate,lithium sulphate monohydrate,lithium sulfate, acs,ksc181s7n |
| IUPAC Name | dilithium;sulfate;hydrate |
| InChI Key | RKGLUDFWIKNKMX-UHFFFAOYSA-L |
| Molecular Formula | H2Li2O5S |
Lithium perchlorate, anhydrous, ACS, 95.0% min
CAS: 3-9-7791 Molecular Formula: ClH6LiO7 Molecular Weight (g/mol): 160.43 MDL Number: MFCD00011079 InChI Key: JAWYRNYHJJDXHX-UHFFFAOYSA-M Synonym: lithium perchlorate,perchloric acid, lithium salt,lithiumperchlorate,unii-q86se98c9c,lithium 1+ ion perchlorate,lithium perchlorate, anhydrous,lithium cloricum,lithium per chlorate,liclo4,perchloric acid, lithium salt 1:1 PubChem CID: 23665649 IUPAC Name: lithium;perchlorate SMILES: [Li+].[O-]Cl(=O)(=O)=O
| PubChem CID | 23665649 |
|---|---|
| CAS | 3-9-7791 |
| Molecular Weight (g/mol) | 160.43 |
| MDL Number | MFCD00011079 |
| SMILES | [Li+].[O-]Cl(=O)(=O)=O |
| Synonym | lithium perchlorate,perchloric acid, lithium salt,lithiumperchlorate,unii-q86se98c9c,lithium 1+ ion perchlorate,lithium perchlorate, anhydrous,lithium cloricum,lithium per chlorate,liclo4,perchloric acid, lithium salt 1:1 |
| IUPAC Name | lithium;perchlorate |
| InChI Key | JAWYRNYHJJDXHX-UHFFFAOYSA-M |
| Molecular Formula | ClH6LiO7 |